C8H3F14I — CID 88505098
1,1,1,2,2,3,3,4,4,5,5,6,6,8-tetradecafluoro-8-iodooctane (PubChem CID 88505098) has the molecular formula C8H3F14I and a molecular weight of 491.99 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,8-tetradecafluoro-8-iodooctane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,8-tetradecafluoro-8-iodooctane |
|---|---|
| PubChem CID | 88505098 |
| Molecular Formula | C8H3F14I |
| Molecular Weight | 491.99 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,8-tetradecafluoro-8-iodooctane |
| SMILES | FC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F14I/c9-2(23)1-3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)22/h2H,1H2 |
| InChIKey | NSWUFNPBDZJYOB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.99 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|