C10H5F18Si — CID 123910850
CID 123910850 (PubChem CID 123910850) has the molecular formula C10H5F18Si and a molecular weight of 495.20 g/mol.
| Compound Name | CID 123910850 |
|---|---|
| PubChem CID | 123910850 |
| Molecular Formula | C10H5F18Si |
| Molecular Weight | 495.20 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | — |
| SMILES | FC([SiH2])CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F18Si/c11-2(29)1-3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)28/h2H,1,29H2 |
| InChIKey | PBGIXSAHSYSPLW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.20 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|