C15H17F17O2Si — CID 54143358
diethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorodecyl)-methylsilane (PubChem CID 54143358) has the molecular formula C15H17F17O2Si and a molecular weight of 580.35 g/mol. Its IUPAC name is diethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorodecyl)-methylsilane.
| Compound Name | diethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorodecyl)-methylsilane |
|---|---|
| PubChem CID | 54143358 |
| Molecular Formula | C15H17F17O2Si |
| Molecular Weight | 580.35 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | diethoxy-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorodecyl)-methylsilane |
| SMILES | CCO[Si](C)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C15H17F17O2Si/c1-5-33-35(4,34-6-2)15(31,32)14(29,30)13(27,28)12(25,26)11(23,24)10(21,22)9(19,20)8(17,18)7(3)16/h7H,5-6H2,1-4H3 |
| InChIKey | OCQIXFBWWAEOJW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.35 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|