C16H22F17NO3Si — CID 174929284
azane;triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane (PubChem CID 174929284) has the molecular formula C16H22F17NO3Si and a molecular weight of 627.41 g/mol. Its IUPAC name is azane;triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane.
| Compound Name | azane;triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane |
|---|---|
| PubChem CID | 174929284 |
| Molecular Formula | C16H22F17NO3Si |
| Molecular Weight | 627.41 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | azane;triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F.N |
| InChI | InChI=1S/C16H19F17O3Si.H3N/c1-4-34-37(35-5-2,36-6-3)10(21)12(24,25)14(28,29)16(32,33)15(30,31)13(26,27)11(22,23)8(18)7(17)9(19)20;/h7-10H,4-6H2,1-3H3;1H3 |
| InChIKey | VNVZHAJZQFNURY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 62.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.41 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|