C15H16F17O2Si — CID 22221751
CID 22221751 (PubChem CID 22221751) has the molecular formula C15H16F17O2Si and a molecular weight of 579.34 g/mol.
| Compound Name | CID 22221751 |
|---|---|
| PubChem CID | 22221751 |
| Molecular Formula | C15H16F17O2Si |
| Molecular Weight | 579.34 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | — |
| SMILES | CCO[Si](CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F)OCC |
| InChI | InChI=1S/C15H16F17O2Si/c1-3-33-35(34-4-2)5-6(16)10(21,22)12(25,26)14(29,30)15(31,32)13(27,28)11(23,24)8(18)7(17)9(19)20/h6-9H,3-5H2,1-2H3 |
| InChIKey | HMSMQFXDWHZJDY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.34 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|