C18H25F15O3SSi — CID 87421934
4,4,5,5,6,6,7,7,8,8,9,10,11,12,12-pentadecafluoro-1-triethoxysilyldodecane-3-thiol (PubChem CID 87421934) has the molecular formula C18H25F15O3SSi and a molecular weight of 634.52 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,10,11,12,12-pentadecafluoro-1-triethoxysilyldodecane-3-thiol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,10,11,12,12-pentadecafluoro-1-triethoxysilyldodecane-3-thiol |
|---|---|
| PubChem CID | 87421934 |
| Molecular Formula | C18H25F15O3SSi |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,10,11,12,12-pentadecafluoro-1-triethoxysilyldodecane-3-thiol |
| SMILES | CCO[Si](CCC(S)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)F)(OCC)OCC |
| InChI | InChI=1S/C18H25F15O3SSi/c1-4-34-38(35-5-2,36-6-3)8-7-9(37)14(24,25)16(28,29)18(32,33)17(30,31)15(26,27)12(21)10(19)11(20)13(22)23/h9-13,37H,4-8H2,1-3H3 |
| InChIKey | RCXVUQZWLUXYNV-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|