C7H4F12S — CID 175037264
1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptane-1-thiol (PubChem CID 175037264) has the molecular formula C7H4F12S and a molecular weight of 348.15 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptane-1-thiol.
| Compound Name | 1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptane-1-thiol |
|---|---|
| PubChem CID | 175037264 |
| Molecular Formula | C7H4F12S |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6,7,7-dodecafluoroheptane-1-thiol |
| SMILES | FC(F)C(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S |
| InChI | InChI=1S/C7H4F12S/c8-1(3(10)11)2(9)4(12,13)5(14,15)6(16,17)7(18,19)20/h1-3,20H |
| InChIKey | ATFSIKCDXKCVBQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|