C11H13F13O2Si — CID 173221103
dimethoxy(2,3,3,4,4,5,5,6,6,7,8,9,9-tridecafluorononyl)silane (PubChem CID 173221103) has the molecular formula C11H13F13O2Si and a molecular weight of 452.28 g/mol. Its IUPAC name is dimethoxy(2,3,3,4,4,5,5,6,6,7,8,9,9-tridecafluorononyl)silane.
| Compound Name | dimethoxy(2,3,3,4,4,5,5,6,6,7,8,9,9-tridecafluorononyl)silane |
|---|---|
| PubChem CID | 173221103 |
| Molecular Formula | C11H13F13O2Si |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | dimethoxy(2,3,3,4,4,5,5,6,6,7,8,9,9-tridecafluorononyl)silane |
| SMILES | CO[SiH](CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F)OC |
| InChI | InChI=1S/C11H13F13O2Si/c1-25-27(26-2)3-4(12)8(17,18)10(21,22)11(23,24)9(19,20)6(14)5(13)7(15)16/h4-7,27H,3H2,1-2H3 |
| InChIKey | RAONXOQZYJTPRQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|