C10H10F14O2Si — CID 175373175
dimethoxy(1,1,2,2,3,3,4,4,5,5,6,8,8,8-tetradecafluorooctyl)silane (PubChem CID 175373175) has the molecular formula C10H10F14O2Si and a molecular weight of 456.25 g/mol. Its IUPAC name is dimethoxy(1,1,2,2,3,3,4,4,5,5,6,8,8,8-tetradecafluorooctyl)silane.
| Compound Name | dimethoxy(1,1,2,2,3,3,4,4,5,5,6,8,8,8-tetradecafluorooctyl)silane |
|---|---|
| PubChem CID | 175373175 |
| Molecular Formula | C10H10F14O2Si |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | dimethoxy(1,1,2,2,3,3,4,4,5,5,6,8,8,8-tetradecafluorooctyl)silane |
| SMILES | CO[SiH](OC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C10H10F14O2Si/c1-25-27(26-2)10(23,24)9(21,22)8(19,20)7(17,18)6(15,16)4(11)3-5(12,13)14/h4,27H,3H2,1-2H3 |
| InChIKey | SSCCECDMBUQZHQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|