C5H3F9 — CID 97291038
(3S)-1,1,1,2,2,3,5,5,5-nonafluoropentane (PubChem CID 97291038) has the molecular formula C5H3F9 and a molecular weight of 234.06 g/mol. Its IUPAC name is (3S)-1,1,1,2,2,3,5,5,5-nonafluoropentane.
| Compound Name | (3S)-1,1,1,2,2,3,5,5,5-nonafluoropentane |
|---|---|
| PubChem CID | 97291038 |
| Molecular Formula | C5H3F9 |
| Molecular Weight | 234.06 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | (3S)-1,1,1,2,2,3,5,5,5-nonafluoropentane |
| SMILES | F[C@@H](CC(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9/c6-2(1-3(7,8)9)4(10,11)5(12,13)14/h2H,1H2/t2-/m0/s1 |
| InChIKey | ODOQEDLJVNKDMU-REOHCLBHSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.06 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|