C16H6F24O4 — CID 175336561
2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctanoyl 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctaneperoxoate (PubChem CID 175336561) has the molecular formula C16H6F24O4 and a molecular weight of 718.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctanoyl 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctaneperoxoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctanoyl 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctaneperoxoate |
|---|---|
| PubChem CID | 175336561 |
| Molecular Formula | C16H6F24O4 |
| Molecular Weight | 718.17 g/mol |
| Exact Mass | 717.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctanoyl 2,2,3,3,4,4,5,5,6,8,8,8-dodecafluorooctaneperoxoate |
| SMILES | O=C(OOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C16H6F24O4/c17-3(1-7(19,20)21)9(25,26)13(33,34)15(37,38)11(29,30)5(41)43-44-6(42)12(31,32)16(39,40)14(35,36)10(27,28)4(18)2-8(22,23)24/h3-4H,1-2H2 |
| InChIKey | OKHGKFRTIIBVNS-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.17 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|