C11H6F16O — CID 141204802
1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,9,9,9-hexadecafluorononane (PubChem CID 141204802) has the molecular formula C11H6F16O and a molecular weight of 458.14 g/mol. Its IUPAC name is 1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,9,9,9-hexadecafluorononane.
| Compound Name | 1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,9,9,9-hexadecafluorononane |
|---|---|
| PubChem CID | 141204802 |
| Molecular Formula | C11H6F16O |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 1-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,9,9,9-hexadecafluorononane |
| SMILES | C=COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C11H6F16O/c1-2-28-11(26,27)10(24,25)9(22,23)8(20,21)7(18,19)6(16,17)4(12)3-5(13,14)15/h2,4H,1,3H2 |
| InChIKey | AOSMWUCBSCQFNZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|