C19H10F20O — CID 151926824
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,11,11,11-icosafluoroundecoxy)ethenylbenzene (PubChem CID 151926824) has the molecular formula C19H10F20O and a molecular weight of 634.25 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,11,11,11-icosafluoroundecoxy)ethenylbenzene.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,11,11,11-icosafluoroundecoxy)ethenylbenzene |
|---|---|
| PubChem CID | 151926824 |
| Molecular Formula | C19H10F20O |
| Molecular Weight | 634.25 g/mol |
| Exact Mass | 634.04 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,11,11,11-icosafluoroundecoxy)ethenylbenzene |
| SMILES | FC(CC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC=Cc1ccccc1 |
| InChI | InChI=1S/C19H10F20O/c20-10(8-11(21,22)23)12(24,25)13(26,27)14(28,29)15(30,31)16(32,33)17(34,35)18(36,37)19(38,39)40-7-6-9-4-2-1-3-5-9/h1-7,10H,8H2 |
| InChIKey | SXXZFUAGGKVBMQ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.25 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|