C11H10F4O — CID 173305402
[(E)-2-(2,2,3,3-tetrafluoropropoxy)ethenyl]benzene (PubChem CID 173305402) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is [(E)-2-(2,2,3,3-tetrafluoropropoxy)ethenyl]benzene.
| Compound Name | [(E)-2-(2,2,3,3-tetrafluoropropoxy)ethenyl]benzene |
|---|---|
| PubChem CID | 173305402 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [(E)-2-(2,2,3,3-tetrafluoropropoxy)ethenyl]benzene |
| SMILES | FC(F)C(F)(F)CO/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H10F4O/c12-10(13)11(14,15)8-16-7-6-9-4-2-1-3-5-9/h1-7,10H,8H2/b7-6+ |
| InChIKey | BKHJWWSMTOWVAE-VOTSOKGWSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|