C24H21F8O2P — CID 10459459
triphenyl-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane (PubChem CID 10459459) has the molecular formula C24H21F8O2P and a molecular weight of 524.39 g/mol. Its IUPAC name is triphenyl-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane.
| Compound Name | triphenyl-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 10459459 |
| Molecular Formula | C24H21F8O2P |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | triphenyl-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane |
| SMILES | FC(F)C(F)(F)COP(OCC(F)(F)C(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21F8O2P/c25-21(26)23(29,30)16-33-35(18-10-4-1-5-11-18,19-12-6-2-7-13-19,20-14-8-3-9-15-20)34-17-24(31,32)22(27)28/h1-15,21-22H,16-17H2 |
| InChIKey | NUPFXXZZKKSLSL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|