C8H7F6OP — CID 23413804
trifluoro-phenyl-(2,2,2-trifluoroethoxy)-λ5-phosphane (PubChem CID 23413804) has the molecular formula C8H7F6OP and a molecular weight of 264.11 g/mol. Its IUPAC name is trifluoro-phenyl-(2,2,2-trifluoroethoxy)-λ5-phosphane.
| Compound Name | trifluoro-phenyl-(2,2,2-trifluoroethoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 23413804 |
| Molecular Formula | C8H7F6OP |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | trifluoro-phenyl-(2,2,2-trifluoroethoxy)-λ5-phosphane |
| SMILES | FC(F)(F)COP(F)(F)(F)c1ccccc1 |
| InChI | InChI=1S/C8H7F6OP/c9-8(10,11)6-15-16(12,13,14)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | SEDBMRIBNQVNMT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|