C46H36Br2F6P2 — CID 59260573
bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-bis(trifluoromethyl)phenyl]methyl]-triphenyl-λ5-phosphane (PubChem CID 59260573) has the molecular formula C46H36Br2F6P2 and a molecular weight of 924.54 g/mol. Its IUPAC name is bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-bis(trifluoromethyl)phenyl]methyl]-triphenyl-λ5-phosphane.
| Compound Name | bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-bis(trifluoromethyl)phenyl]methyl]-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 59260573 |
| Molecular Formula | C46H36Br2F6P2 |
| Molecular Weight | 924.54 g/mol |
| Exact Mass | 922.06 |
| IUPAC Name | bromo-[[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,5-bis(trifluoromethyl)phenyl]methyl]-triphenyl-λ5-phosphane |
| SMILES | FC(F)(F)c1cc(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c(C(F)(F)F)cc1CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H36Br2F6P2/c47-55(37-19-7-1-8-20-37,38-21-9-2-10-22-38,39-23-11-3-12-24-39)33-35-31-44(46(52,53)54)36(32-43(35)45(49,50)51)34-56(48,40-25-13-4-14-26-40,41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-32H,33-34H2 |
| InChIKey | LQQBQOXFHLGTJR-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.54 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|