C8H7F5OP+ — CID 23234580
difluoro-phenyl-(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 23234580) has the molecular formula C8H7F5OP+ and a molecular weight of 245.11 g/mol. Its IUPAC name is difluoro-phenyl-(2,2,2-trifluoroethoxy)phosphanium.
| Compound Name | difluoro-phenyl-(2,2,2-trifluoroethoxy)phosphanium |
|---|---|
| PubChem CID | 23234580 |
| Molecular Formula | C8H7F5OP+ |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | difluoro-phenyl-(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | FC(F)(F)CO[P+](F)(F)c1ccccc1 |
| InChI | InChI=1S/C8H7F5OP/c9-8(10,11)6-14-15(12,13)7-4-2-1-3-5-7/h1-5H,6H2/q+1 |
| InChIKey | SMFNCQNBEBATSZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|