C10H10ClF3O3 — CID 66764263
(2R)-2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid;hydrochloride (PubChem CID 66764263) has the molecular formula C10H10ClF3O3 and a molecular weight of 270.63 g/mol. Its IUPAC name is (2R)-2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid;hydrochloride.
| Compound Name | (2R)-2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 66764263 |
| Molecular Formula | C10H10ClF3O3 |
| Molecular Weight | 270.63 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (2R)-2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H](OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H9F3O3.ClH/c11-10(12,13)6-16-8(9(14)15)7-4-2-1-3-5-7;/h1-5,8H,6H2,(H,14,15);1H/t8-;/m1./s1 |
| InChIKey | FLEWNAGMLQMCGO-DDWIOCJRSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |