C15H13F3N2O4S — CID 99646668
(2S)-2-phenyl-N-pyridin-3-ylsulfonyl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 99646668) has the molecular formula C15H13F3N2O4S and a molecular weight of 374.34 g/mol. Its IUPAC name is (2S)-2-phenyl-N-pyridin-3-ylsulfonyl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | (2S)-2-phenyl-N-pyridin-3-ylsulfonyl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 99646668 |
| Molecular Formula | C15H13F3N2O4S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (2S)-2-phenyl-N-pyridin-3-ylsulfonyl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(NS(=O)(=O)c1cccnc1)[C@@H](OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O4S/c16-15(17,18)10-24-13(11-5-2-1-3-6-11)14(21)20-25(22,23)12-7-4-8-19-9-12/h1-9,13H,10H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | XLGOAKSPHAGJLY-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |