C8H10N2O5S — CID 104935920
(2S)-2-hydroxy-3-(pyridin-3-ylsulfonylamino)propanoic acid (PubChem CID 104935920) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-(pyridin-3-ylsulfonylamino)propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-(pyridin-3-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 104935920 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (2S)-2-hydroxy-3-(pyridin-3-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)[C@@H](O)CNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C8H10N2O5S/c11-7(8(12)13)5-10-16(14,15)6-2-1-3-9-4-6/h1-4,7,10-11H,5H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | FSKJRMDBMXGEAY-ZETCQYMHSA-N |
| XLogP | -1.19 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |