C15H16N2O4S — CID 94189477
(2R)-2-phenylmethoxy-N-pyridin-3-ylsulfonylpropanamide (PubChem CID 94189477) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is (2R)-2-phenylmethoxy-N-pyridin-3-ylsulfonylpropanamide.
| Compound Name | (2R)-2-phenylmethoxy-N-pyridin-3-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 94189477 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (2R)-2-phenylmethoxy-N-pyridin-3-ylsulfonylpropanamide |
| SMILES | C[C@@H](OCc1ccccc1)C(=O)NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C15H16N2O4S/c1-12(21-11-13-6-3-2-4-7-13)15(18)17-22(19,20)14-8-5-9-16-10-14/h2-10,12H,11H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | YSOBZEBVNCLLKW-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |