C8H10F2N2O3S — CID 104858661
N-(2,2-difluoro-3-hydroxypropyl)pyridine-3-sulfonamide (PubChem CID 104858661) has the molecular formula C8H10F2N2O3S and a molecular weight of 252.24 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)pyridine-3-sulfonamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104858661 |
| Molecular Formula | C8H10F2N2O3S |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)CO)c1cccnc1 |
| InChI | InChI=1S/C8H10F2N2O3S/c9-8(10,6-13)5-12-16(14,15)7-2-1-3-11-4-7/h1-4,12-13H,5-6H2 |
| InChIKey | OYQQDRXGFYUVRY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |