C10H14F2N2O3S — CID 106165658
4-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylbenzenesulfonamide (PubChem CID 106165658) has the molecular formula C10H14F2N2O3S and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylbenzenesulfonamide.
| Compound Name | 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106165658 |
| Molecular Formula | C10H14F2N2O3S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-amino-N-(2,2-difluoro-3-hydroxypropyl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(F)(F)CO)ccc1N |
| InChI | InChI=1S/C10H14F2N2O3S/c1-7-4-8(2-3-9(7)13)18(16,17)14-5-10(11,12)6-15/h2-4,14-15H,5-6,13H2,1H3 |
| InChIKey | NWPOHOPQJRSDPC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|