C10H13F3N2O3S — CID 106165792
5-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 106165792) has the molecular formula C10H13F3N2O3S and a molecular weight of 298.29 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106165792 |
| Molecular Formula | C10H13F3N2O3S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-amino-N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(N)cc1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C10H13F3N2O3S/c1-6-2-7(11)8(14)3-9(6)19(17,18)15-4-10(12,13)5-16/h2-3,15-16H,4-5,14H2,1H3 |
| InChIKey | PAJMGYJMDKXZBK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|