C9H8F6N2O2S — CID 106289392
5-amino-2,4-difluoro-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 106289392) has the molecular formula C9H8F6N2O2S and a molecular weight of 322.23 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106289392 |
| Molecular Formula | C9H8F6N2O2S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCC(F)(F)C(F)F)c(F)cc1F |
| InChI | InChI=1S/C9H8F6N2O2S/c10-4-1-5(11)7(2-6(4)16)20(18,19)17-3-9(14,15)8(12)13/h1-2,8,17H,3,16H2 |
| InChIKey | NZURGIQKHDLEAB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|