C11H18N2O4S — CID 103835036
N-(2-hydroxy-4-methoxy-2-methylbutyl)pyridine-3-sulfonamide (PubChem CID 103835036) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is N-(2-hydroxy-4-methoxy-2-methylbutyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-hydroxy-4-methoxy-2-methylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103835036 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-(2-hydroxy-4-methoxy-2-methylbutyl)pyridine-3-sulfonamide |
| SMILES | COCCC(C)(O)CNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H18N2O4S/c1-11(14,5-7-17-2)9-13-18(15,16)10-4-3-6-12-8-10/h3-4,6,8,13-14H,5,7,9H2,1-2H3 |
| InChIKey | RTSIEFOHNBIMOD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |