C12H18N2O4S — CID 43624461
methyl 2-methyl-2-(pyridin-3-ylsulfonylamino)pentanoate (PubChem CID 43624461) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is methyl 2-methyl-2-(pyridin-3-ylsulfonylamino)pentanoate.
| Compound Name | methyl 2-methyl-2-(pyridin-3-ylsulfonylamino)pentanoate |
|---|---|
| PubChem CID | 43624461 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl 2-methyl-2-(pyridin-3-ylsulfonylamino)pentanoate |
| SMILES | CCCC(C)(NS(=O)(=O)c1cccnc1)C(=O)OC |
| InChI | InChI=1S/C12H18N2O4S/c1-4-7-12(2,11(15)18-3)14-19(16,17)10-6-5-8-13-9-10/h5-6,8-9,14H,4,7H2,1-3H3 |
| InChIKey | ZCASNRGBUCJWGZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |