C11H17NO4S2 — CID 93045702
methyl (2R)-2-methyl-2-(thiophen-2-ylsulfonylamino)pentanoate (PubChem CID 93045702) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl (2R)-2-methyl-2-(thiophen-2-ylsulfonylamino)pentanoate.
| Compound Name | methyl (2R)-2-methyl-2-(thiophen-2-ylsulfonylamino)pentanoate |
|---|---|
| PubChem CID | 93045702 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | methyl (2R)-2-methyl-2-(thiophen-2-ylsulfonylamino)pentanoate |
| SMILES | CCC[C@@](C)(NS(=O)(=O)c1cccs1)C(=O)OC |
| InChI | InChI=1S/C11H17NO4S2/c1-4-7-11(2,10(13)16-3)12-18(14,15)9-6-5-8-17-9/h5-6,8,12H,4,7H2,1-3H3/t11-/m1/s1 |
| InChIKey | QNKSJYFHIOKZRQ-LLVKDONJSA-N |
| XLogP | 1.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |