C8H8F3NO5S2 — CID 3619840
methyl 3,3,3-trifluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 3619840) has the molecular formula C8H8F3NO5S2 and a molecular weight of 319.28 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 3619840 |
| Molecular Formula | C8H8F3NO5S2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | COC(=O)C(O)(NS(=O)(=O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO5S2/c1-17-6(13)7(14,8(9,10)11)12-19(15,16)5-3-2-4-18-5/h2-4,12,14H,1H3 |
| InChIKey | MUNYZHDECDCDGR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|