C13H15FN4O6S2 — CID 139722248
N-(4,6-dimethoxypyrimidin-2-yl)-3-fluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 139722248) has the molecular formula C13H15FN4O6S2 and a molecular weight of 406.42 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-3-fluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-3-fluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 139722248 |
| Molecular Formula | C13H15FN4O6S2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-3-fluoro-2-hydroxy-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | COc1cc(OC)nc(NC(=O)C(O)(CF)NS(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C13H15FN4O6S2/c1-23-8-6-9(24-2)16-12(15-8)17-11(19)13(20,7-14)18-26(21,22)10-4-3-5-25-10/h3-6,18,20H,7H2,1-2H3,(H,15,16,17,19) |
| InChIKey | RKLWXXUJFZFPIZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|