C14H17FN4O6S2 — CID 14014026
1-(4,6-dimethoxypyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea (PubChem CID 14014026) has the molecular formula C14H17FN4O6S2 and a molecular weight of 420.44 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea |
|---|---|
| PubChem CID | 14014026 |
| Molecular Formula | C14H17FN4O6S2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2sccc2COCCF)n1 |
| InChI | InChI=1S/C14H17FN4O6S2/c1-23-10-7-11(24-2)17-13(16-10)18-14(20)19-27(21,22)12-9(3-6-26-12)8-25-5-4-15/h3,6-7H,4-5,8H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | VETLYJCKXYTDEZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|