C17H16N4O5S2 — CID 13366185
1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-thiophen-2-ylphenyl)sulfonylurea (PubChem CID 13366185) has the molecular formula C17H16N4O5S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-thiophen-2-ylphenyl)sulfonylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-thiophen-2-ylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 13366185 |
| Molecular Formula | C17H16N4O5S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-thiophen-2-ylphenyl)sulfonylurea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2ccccc2-c2cccs2)n1 |
| InChI | InChI=1S/C17H16N4O5S2/c1-25-14-10-15(26-2)19-16(18-14)20-17(22)21-28(23,24)13-8-4-3-6-11(13)12-7-5-9-27-12/h3-10H,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | DLGZAZBVEIINIW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |