C14H13F3N4O6S2 — CID 23178446
1-[4-methoxy-6-(trifluoromethoxy)pyrimidin-2-yl]-3-(2-methylsulfinylphenyl)sulfonylurea (PubChem CID 23178446) has the molecular formula C14H13F3N4O6S2 and a molecular weight of 454.41 g/mol. Its IUPAC name is 1-[4-methoxy-6-(trifluoromethoxy)pyrimidin-2-yl]-3-(2-methylsulfinylphenyl)sulfonylurea.
| Compound Name | 1-[4-methoxy-6-(trifluoromethoxy)pyrimidin-2-yl]-3-(2-methylsulfinylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 23178446 |
| Molecular Formula | C14H13F3N4O6S2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 1-[4-methoxy-6-(trifluoromethoxy)pyrimidin-2-yl]-3-(2-methylsulfinylphenyl)sulfonylurea |
| SMILES | COc1cc(OC(F)(F)F)nc(NC(=O)NS(=O)(=O)c2ccccc2S(C)=O)n1 |
| InChI | InChI=1S/C14H13F3N4O6S2/c1-26-10-7-11(27-14(15,16)17)19-12(18-10)20-13(22)21-29(24,25)9-6-4-3-5-8(9)28(2)23/h3-7H,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | FFQPRKAPOBQOHE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |