C12H13N3O4S — CID 115354802
2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 115354802) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115354802 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | COc1cc(OC)nc(NC(C(=O)O)c2cccs2)n1 |
| InChI | InChI=1S/C12H13N3O4S/c1-18-8-6-9(19-2)14-12(13-8)15-10(11(16)17)7-4-3-5-20-7/h3-6,10H,1-2H3,(H,16,17)(H,13,14,15) |
| InChIKey | XRQWZUBRAXXAGR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |