C12H11N3O5S — CID 115321276
2-[(6-methoxy-3-nitro-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 115321276) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is 2-[(6-methoxy-3-nitro-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(6-methoxy-3-nitro-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115321276 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-[(6-methoxy-3-nitro-2-pyridinyl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(NC(C(=O)O)c2cccs2)n1 |
| InChI | InChI=1S/C12H11N3O5S/c1-20-9-5-4-7(15(18)19)11(13-9)14-10(12(16)17)8-3-2-6-21-8/h2-6,10H,1H3,(H,13,14)(H,16,17) |
| InChIKey | YSIMHTMBFZTWPP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|