C12H15N3O2S — CID 115354957
4,6-dimethoxy-N-(1-thiophen-2-ylethyl)pyrimidin-2-amine (PubChem CID 115354957) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(1-thiophen-2-ylethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(1-thiophen-2-ylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115354957 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4,6-dimethoxy-N-(1-thiophen-2-ylethyl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NC(C)c2cccs2)n1 |
| InChI | InChI=1S/C12H15N3O2S/c1-8(9-5-4-6-18-9)13-12-14-10(16-2)7-11(15-12)17-3/h4-8H,1-3H3,(H,13,14,15) |
| InChIKey | HHIGGPWAWKXOMO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |