C11H15N5OS — CID 80780976
6-ethoxy-2-N-(1-thiophen-2-ylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80780976) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 6-ethoxy-2-N-(1-thiophen-2-ylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(1-thiophen-2-ylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80780976 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6-ethoxy-2-N-(1-thiophen-2-ylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(NC(C)c2cccs2)n1 |
| InChI | InChI=1S/C11H15N5OS/c1-3-17-11-15-9(12)14-10(16-11)13-7(2)8-5-4-6-18-8/h4-7H,3H2,1-2H3,(H3,12,13,14,15,16) |
| InChIKey | UCTLOOMDYLYMHP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |