C13H17N4SY- — CID 59879797
4-methyl-6-propan-2-yl-N-(1-thiophen-2-ylethyl)-1,3,5-triazin-2-amine;yttrium (PubChem CID 59879797) has the molecular formula C13H17N4SY- and a molecular weight of 350.28 g/mol. Its IUPAC name is 4-methyl-6-propan-2-yl-N-(1-thiophen-2-ylethyl)-1,3,5-triazin-2-amine;yttrium.
| Compound Name | 4-methyl-6-propan-2-yl-N-(1-thiophen-2-ylethyl)-1,3,5-triazin-2-amine;yttrium |
|---|---|
| PubChem CID | 59879797 |
| Molecular Formula | C13H17N4SY- |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 4-methyl-6-propan-2-yl-N-(1-thiophen-2-ylethyl)-1,3,5-triazin-2-amine;yttrium |
| SMILES | Cc1nc(NC(C)c2cccs2)nc([C-](C)C)n1.[Y] |
| InChI | InChI=1S/C13H17N4S.Y/c1-8(2)12-15-10(4)16-13(17-12)14-9(3)11-6-5-7-18-11;/h5-7,9H,1-4H3,(H,14,15,16,17);/q-1; |
| InChIKey | ZHUQQOCDSRHQJU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|