C15H18FN4Y- — CID 59879787
N-[1-(4-fluorophenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium (PubChem CID 59879787) has the molecular formula C15H18FN4Y- and a molecular weight of 362.24 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium |
|---|---|
| PubChem CID | 59879787 |
| Molecular Formula | C15H18FN4Y- |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium |
| SMILES | Cc1nc(NC(C)c2ccc(F)cc2)nc([C-](C)C)n1.[Y] |
| InChI | InChI=1S/C15H18FN4.Y/c1-9(2)14-18-11(4)19-15(20-14)17-10(3)12-5-7-13(16)8-6-12;/h5-8,10H,1-4H3,(H,17,18,19,20);/q-1; |
| InChIKey | CPVWFMOKEWJZKO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|