C17H23N4Y- — CID 59879759
N-[1-(3,4-dimethylphenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium (PubChem CID 59879759) has the molecular formula C17H23N4Y- and a molecular weight of 372.31 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium.
| Compound Name | N-[1-(3,4-dimethylphenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium |
|---|---|
| PubChem CID | 59879759 |
| Molecular Formula | C17H23N4Y- |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)ethyl]-4-methyl-6-propan-2-yl-1,3,5-triazin-2-amine;yttrium |
| SMILES | Cc1nc(NC(C)c2ccc(C)c(C)c2)nc([C-](C)C)n1.[Y] |
| InChI | InChI=1S/C17H23N4.Y/c1-10(2)16-19-14(6)20-17(21-16)18-13(5)15-8-7-11(3)12(4)9-15;/h7-9,13H,1-6H3,(H,18,19,20,21);/q-1; |
| InChIKey | RVFVWLJOJOISOJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|