C15H17ClN2 — CID 83164219
4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]pyridin-3-amine (PubChem CID 83164219) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]pyridin-3-amine.
| Compound Name | 4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 83164219 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]pyridin-3-amine |
| SMILES | Cc1ccc(C(C)Nc2cnccc2Cl)cc1C |
| InChI | InChI=1S/C15H17ClN2/c1-10-4-5-13(8-11(10)2)12(3)18-15-9-17-7-6-14(15)16/h4-9,12,18H,1-3H3 |
| InChIKey | KCXSWZIUPRZCIF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |