C12H20N2 — CID 83004020
2-[1-(3,4-dimethylphenyl)ethyl]-1,1-dimethylhydrazine (PubChem CID 83004020) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylphenyl)ethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[1-(3,4-dimethylphenyl)ethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83004020 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-[1-(3,4-dimethylphenyl)ethyl]-1,1-dimethylhydrazine |
| SMILES | Cc1ccc(C(C)NN(C)C)cc1C |
| InChI | InChI=1S/C12H20N2/c1-9-6-7-12(8-10(9)2)11(3)13-14(4)5/h6-8,11,13H,1-5H3 |
| InChIKey | FUXGHXLAPXQALH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|