C13H22 — CID 142019921
1,2-dimethyl-4-propan-2-ylbenzene;ethane (PubChem CID 142019921) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 1,2-dimethyl-4-propan-2-ylbenzene;ethane.
| Compound Name | 1,2-dimethyl-4-propan-2-ylbenzene;ethane |
|---|---|
| PubChem CID | 142019921 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1,2-dimethyl-4-propan-2-ylbenzene;ethane |
| SMILES | CC.Cc1ccc(C(C)C)cc1C |
| InChI | InChI=1S/C11H16.C2H6/c1-8(2)11-6-5-9(3)10(4)7-11;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | WCIMTNIMAHNEOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |