About CID 163232916
CID 163232916 (PubChem CID 163232916) has the molecular formula C13H22B
and a molecular weight of 189.13 g/mol.
Molecular Properties
| Compound Name | CID 163232916 |
| PubChem CID | 163232916 |
| Molecular Formula | C13H22B |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.18 |
| IUPAC Name | — |
| SMILES | CC.C[B]c1cc(C(C)C)ccc1C |
| InChI | InChI=1S/C11H16B.C2H6/c1-8(2)10-6-5-9(3)11(7-10)12-4;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | WELKAHPWQBDFBV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163232916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163232916?
The IUPAC name of CID 163232916 (CID 163232916) is not available.
What is the SMILES notation for CID 163232916?
The canonical SMILES for CID 163232916 is CC.C[B]c1cc(C(C)C)ccc1C.
What is the InChIKey of CID 163232916?
The InChIKey is WELKAHPWQBDFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16B.C2H6/c1-8(2)10-6-5-9(3)11(7-10)12-4;1-2/h5-8H,1-4H3;1-2H3.
What are the key properties of CID 163232916?
CID 163232916 has a molecular weight of 189.13 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163232916 is sourced from PubChem (CID 163232916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).