C14H16FN3 — CID 60726849
N-[1-(4-fluorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine (PubChem CID 60726849) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 60726849 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NC(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H16FN3/c1-9-8-10(2)17-14(16-9)18-11(3)12-4-6-13(15)7-5-12/h4-8,11H,1-3H3,(H,16,17,18) |
| InChIKey | SNHQGFKELZPICJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |