C11H10F2N4 — CID 19897292
4,6-difluoro-N-(1-phenylethyl)-1,3,5-triazin-2-amine (PubChem CID 19897292) has the molecular formula C11H10F2N4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4,6-difluoro-N-(1-phenylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-difluoro-N-(1-phenylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 19897292 |
| Molecular Formula | C11H10F2N4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 4,6-difluoro-N-(1-phenylethyl)-1,3,5-triazin-2-amine |
| SMILES | CC(Nc1nc(F)nc(F)n1)c1ccccc1 |
| InChI | InChI=1S/C11H10F2N4/c1-7(8-5-3-2-4-6-8)14-11-16-9(12)15-10(13)17-11/h2-7H,1H3,(H,14,15,16,17) |
| InChIKey | SAQYMZPTMUDUJV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |