C35H30N4P2 — CID 44516135
4,6-bis(diphenylphosphanyl)-N-[(1R)-1-phenylethyl]-1,3,5-triazin-2-amine (PubChem CID 44516135) has the molecular formula C35H30N4P2 and a molecular weight of 568.60 g/mol. Its IUPAC name is 4,6-bis(diphenylphosphanyl)-N-[(1R)-1-phenylethyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(diphenylphosphanyl)-N-[(1R)-1-phenylethyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 44516135 |
| Molecular Formula | C35H30N4P2 |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 4,6-bis(diphenylphosphanyl)-N-[(1R)-1-phenylethyl]-1,3,5-triazin-2-amine |
| SMILES | C[C@@H](Nc1nc(P(c2ccccc2)c2ccccc2)nc(P(c2ccccc2)c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C35H30N4P2/c1-27(28-17-7-2-8-18-28)36-33-37-34(40(29-19-9-3-10-20-29)30-21-11-4-12-22-30)39-35(38-33)41(31-23-13-5-14-24-31)32-25-15-6-16-26-32/h2-27H,1H3,(H,36,37,38,39)/t27-/m1/s1 |
| InChIKey | VNBKGPVPTIKJIX-HHHXNRCGSA-N |
| XLogP | 5.56 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|