C19H20ClN5 — CID 3767089
6-chloro-2-N,4-N-bis(1-phenylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 3767089) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(1-phenylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(1-phenylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3767089 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(1-phenylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Nc1nc(Cl)nc(NC(C)c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C19H20ClN5/c1-13(15-9-5-3-6-10-15)21-18-23-17(20)24-19(25-18)22-14(2)16-11-7-4-8-12-16/h3-14H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | VUHZBRPMEFMEPF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |