C14H13F2N — CID 43195985
3,5-difluoro-N-(1-phenylethyl)aniline (PubChem CID 43195985) has the molecular formula C14H13F2N and a molecular weight of 233.26 g/mol. Its IUPAC name is 3,5-difluoro-N-(1-phenylethyl)aniline.
| Compound Name | 3,5-difluoro-N-(1-phenylethyl)aniline |
|---|---|
| PubChem CID | 43195985 |
| Molecular Formula | C14H13F2N |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3,5-difluoro-N-(1-phenylethyl)aniline |
| SMILES | CC(Nc1cc(F)cc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H13F2N/c1-10(11-5-3-2-4-6-11)17-14-8-12(15)7-13(16)9-14/h2-10,17H,1H3 |
| InChIKey | ZBQUPYXCYNKMEP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |